<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-05-31 13:45:58 -0600</creation_date>
  <update_date>2015-06-03 15:53:46 -0600</update_date>
  <accession>ECMDB01131</accession>
  <m2m_id>M2MDB000267</m2m_id>
  <name>Iminoaspartic acid</name>
  <description>Iminoaspartic acid (alpha-iminosuccinate) is an intermediate in NAD biosynthesis from aspartate pathwyay. As a general rule, most prokaryotes utilize the aspartate de novo pathway, in which the nicotinate moiety of NAD is synthesized from aspartate, while in eukaryotes, the de novo pathway starts with tryptophan.</description>
  <synonyms>
    <synonym>a-Iminosuccinate</synonym>
    <synonym>a-Iminosuccinic acid</synonym>
    <synonym>Alpha-Iminosuccinate</synonym>
    <synonym>Alpha-Iminosuccinic acid</synonym>
    <synonym>Imino-Butanedioate</synonym>
    <synonym>Imino-Butanedioic acid</synonym>
    <synonym>Iminoaspartate</synonym>
    <synonym>Iminoaspartic acid</synonym>
    <synonym>Iminosuccinate</synonym>
    <synonym>Iminosuccinic acid</synonym>
    <synonym>α-Iminosuccinate</synonym>
    <synonym>α-Iminosuccinic acid</synonym>
  </synonyms>
  <chemical_formula>C4H5NO4</chemical_formula>
  <average_molecular_weight>131.0868</average_molecular_weight>
  <monisotopic_moleculate_weight>131.021857653</monisotopic_moleculate_weight>
  <iupac_name>2-iminobutanedioic acid</iupac_name>
  <traditional_iupac>iminosuccinic acid</traditional_iupac>
  <cas_registry_number>79067-61-1</cas_registry_number>
  <smiles>OC(=O)CC(=N)C(O)=O</smiles>
  <inchi>InChI=1S/C4H5NO4/c5-2(4(8)9)1-3(6)7/h5H,1H2,(H,6,7)(H,8,9)</inchi>
  <inchikey>NMUOATVLLQEYHI-UHFFFAOYSA-N</inchikey>
  <state>Solid</state>
  <cellular_locations>
    <cellular_location>Cytosol</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-0.83</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-1.49</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>4.26e+00 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>-0.51</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>3.28</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_basic</kind>
    <value>2.48</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>2-iminobutanedioic acid</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>131.0868</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>131.021857653</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>OC(=O)CC(=N)C(O)=O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C4H5NO4</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C4H5NO4/c5-2(4(8)9)1-3(6)7/h5H,1H2,(H,6,7)(H,8,9)</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>NMUOATVLLQEYHI-UHFFFAOYSA-N</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>98.45</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>36.81</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>10.55</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>3</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>5</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>3</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Alanine, aspartate and glutamate metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00250</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Nicotinate and nicotinamide metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00760</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Metabolic pathways</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco01100</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>NAD biosynthesis</name>
      <description>Nicotinamide adenine dinucleotide (NAD) can be biosynthesized from L-aspartic acid.This amino acid reacts with oxygen through an L-aspartate oxidase resulting in a hydrogen ion, hydrogen peroxide and an iminoaspartic acid. The latter compound interacts with dihydroxyacetone phosphate through a quinolinate synthase A, resulting in a phosphate, water, and a quinolic acid. Quinolic acid interacts with phosphoribosyl pyrophosphate and hydrogen ion through a quinolinate phosphoribosyltransferase resulting in pyrophosphate, carbon dioxide and nicotinate beta-D-ribonucleotide. This last compound is adenylated through an ATP driven nicotinate-mononucleotide adenylyltransferase releasing a pyrophosphate and resulting in a nicotinic acid adenine dinucleotide.
Nicotinic acid adenine dinucleotide is processed through an NAD synthetase, NH3-dependent in two different manners.
In the first case, Nicotinic acid adenine dinucleotide interacts with ATP, L-glutamine and water through the enzyme and results in hydrogen ion, AMP, pyrophosphate, L-glutamic acid and NAD.
In the second case, Nicotinic acid adenine dinucleotide interacts with ATP and ammonium through the enzyme resulting in a pyrophosphate, AMP, hydrogen ion and NAD.
NAD then proceeds to regulate its own pathway by repressing L-aspartate oxidase.
As a general rule, most prokaryotes utilize the aspartate de novo pathway, in which the nicotinate moiety of NAD is synthesized from aspartate , while in eukaryotes, the de novo pathway starts with tryptophan.

</description>
      <pathwhiz_id>PW000829</pathwhiz_id>
      <kegg_map_id/>
      <subject>Metabolic</subject>
    </pathway>
    <pathway>
      <name>NAD biosynthesis I (from aspartate)</name>
      <ecocyc_pathway_id>PYRIDNUCSYN-PWY</ecocyc_pathway_id>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>3108</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>37940</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>132222</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>139956</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259728</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259729</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259730</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259731</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259732</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259733</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259734</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259735</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259736</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259737</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259738</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259739</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259740</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259741</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259742</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259743</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259744</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259745</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259746</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>259747</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>28265</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>28266</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>28267</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34823</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34824</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>34825</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2746079</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2746080</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2746081</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2936776</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2936777</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2936778</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id>HMDB01131</hmdb_id>
  <pubchem_compound_id>796</pubchem_compound_id>
  <chemspider_id>13628208</chemspider_id>
  <kegg_id>C05840</kegg_id>
  <chebi_id/>
  <biocyc_id>IMINOASPARTATE</biocyc_id>
  <het_id/>
  <wikipidia/>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590.</reference_text>
      <pubmed_id>21097882</pubmed_id>
    </reference>
    <reference>
      <reference_text>Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114.</reference_text>
      <pubmed_id>22080510</pubmed_id>
    </reference>
    <reference>
      <reference_text>van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25.</reference_text>
      <pubmed_id>17765195</pubmed_id>
    </reference>
    <reference>
      <reference_text>Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948.</reference_text>
      <pubmed_id>18331064</pubmed_id>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>L-aspartate oxidase</name>
      <uniprot_id>P10902</uniprot_id>
      <uniprot_name>NADB_ECOLI</uniprot_name>
      <gene_name>nadB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P10902.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Quinolinate synthase A</name>
      <uniprot_id>P11458</uniprot_id>
      <uniprot_name>NADA_ECOLI</uniprot_name>
      <gene_name>nadA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P11458.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
  </transporters>
  <reactions>
    <reaction_text>Dihydroxyacetone phosphate + Iminoaspartic acid &lt;&gt;2 Water + Phosphate + Quinolinic acid</reaction_text>
    <kegg_reaction_id>R04292</kegg_reaction_id>
    <ecocyc_id>QUINOLINATE-SYNTHA-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Fumaric acid &gt; Hydrogen ion + Iminoaspartic acid + Succinic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN-9772</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Oxygen &lt;&gt; Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid</reaction_text>
    <kegg_reaction_id>R00481</kegg_reaction_id>
    <ecocyc_id>L-ASPARTATE-OXID-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Ubiquinone-8 &gt; Hydrogen ion + Iminoaspartic acid + Ubiquinol-8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Menaquinone 8 &gt; Hydrogen ion + Iminoaspartic acid + Menaquinol 8</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Oxygen &lt;&gt; Iminoaspartic acid + Hydrogen peroxide</reaction_text>
    <kegg_reaction_id>R00481</kegg_reaction_id>
    <ecocyc_id>L-ASPARTATE-OXID-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Quinolinic acid + 2 Water + Phosphate &lt;&gt; Iminoaspartic acid + Dihydroxyacetone phosphate</reaction_text>
    <kegg_reaction_id>R04292</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Oxygen + L-Aspartic acid &gt; Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>L-ASPARTATE-OXID-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Iminoaspartic acid + Dihydroxyacetone phosphate &gt; Quinolinic acid + Water + Phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>QUINOLINATE-SYNTHA-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Dihydroxyacetone phosphate + Iminoaspartic acid &gt; Quinolinic acid +2 Water + Inorganic phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Oxygen &gt; Iminoaspartic acid + Hydrogen peroxide</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Oxygen + L-Aspartic acid &gt; Hydrogen peroxide + Hydrogen ion + Iminoaspartic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003007</pw_reaction_id>
    <reaction_text>Iminoaspartic acid + Dihydroxyacetone phosphate &gt; Phosphate +2 Water + Quinolinic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id>PW_R003008</pw_reaction_id>
    <reaction_text>L-Aspartic acid + Oxygen &lt;&gt; Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydroxyacetone phosphate + Iminoaspartic acid &lt;&gt;2 Water + Phosphate + Quinolinic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Quinolinic acid + 2 Water + Phosphate &lt;&gt; Iminoaspartic acid + Dihydroxyacetone phosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>L-Aspartic acid + Oxygen &lt;&gt; Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Dihydroxyacetone phosphate + Iminoaspartic acid &lt;&gt;2 Water + Phosphate + Quinolinic acid</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
