<?xml version="1.0" encoding="UTF-8"?>
<compound>
  <version>2.0</version>
  <creation_date>2012-05-31 13:58:01 -0600</creation_date>
  <update_date>2015-06-03 15:54:20 -0600</update_date>
  <accession>ECMDB03178</accession>
  <m2m_id>M2MDB000481</m2m_id>
  <name>Heme</name>
  <description>Heme B or haem B (also known as protoheme IX) is the most abundant heme in nature. E. coli is known to produce 4 different hemes: protoheme IX (heme B), heme C, heme D, and siroheme. A heme or haem is a prosthetic group that consists of an iron atom contained in the center of a large heterocyclic organic ring called a porphyrin. Not all porphyrins contain iron, but a substantial fraction of porphyrin-containing metalloproteins have heme as their prosthetic subunit; these are known as hemoproteins. Generally, heme B is attached to the surrounding protein matrix (known as the apoprotein) through a single coordination bond between the heme iron and an amino-acid side-chain. When oxygen is bound the iron becomes hexacoordinated. Since the iron in heme B containing proteins is bound to the four nitrogens of the porphyrin (forming a plane) and a single electron donating atom of the protein, the iron is often in a pentacoordinate state.</description>
  <synonyms>
    <synonym>(protoporphyrinato)iron</synonym>
    <synonym>Ferroheme</synonym>
    <synonym>Ferroheme b</synonym>
    <synonym>Ferroprotoheme</synonym>
    <synonym>Ferroprotoporphyrin</synonym>
    <synonym>Ferroprotoporphyrin IX</synonym>
    <synonym>Ferrous protoheme</synonym>
    <synonym>Ferrous protoheme IX</synonym>
    <synonym>Haem</synonym>
    <synonym>Hem</synonym>
    <synonym>Heme</synonym>
    <synonym>Heme &lt;i&gt;b&lt;/i&gt;</synonym>
    <synonym>Heme b</synonym>
    <synonym>Iron protoporphyrin</synonym>
    <synonym>Iron protoporphyrin IX</synonym>
    <synonym>Iron(II) protoporphyrin IX</synonym>
    <synonym>Protoferroheme</synonym>
    <synonym>Protohaem</synonym>
    <synonym>Protoheme</synonym>
    <synonym>Protoheme IX</synonym>
    <synonym>Reduced hematin</synonym>
  </synonyms>
  <chemical_formula>C34H32FeN4O4</chemical_formula>
  <average_molecular_weight>616.487</average_molecular_weight>
  <monisotopic_moleculate_weight>616.177297665</monisotopic_moleculate_weight>
  <iupac_name>4,20-bis(2-carboxyethyl)-10,15-diethenyl-5,9,14,19-tetramethyl-2lambda5,22,23lambda5,25-tetraaza-1-ferraoctacyclo[11.9.1.1^{1,8}.1^{3,21}.0^{2,6}.0^{16,23}.0^{18,22}.0^{11,25}]pentacosa-2,4,6,8,10,12,14,16(23),17,19,21(24)-undecaene-2,23-bis(ylium)-1,1-diuide</iupac_name>
  <traditional_iupac>4,20-bis(2-carboxyethyl)-10,15-diethenyl-5,9,14,19-tetramethyl-2lambda5,22,23lambda5,25-tetraaza-1-ferraoctacyclo[11.9.1.1^{1,8}.1^{3,21}.0^{2,6}.0^{16,23}.0^{18,22}.0^{11,25}]pentacosa-2,4,6,8,10,12,14,16(23),17,19,21(24)-undecaene-2,23-bis(ylium)-1,1-diuide</traditional_iupac>
  <cas_registry_number>14875-96-8</cas_registry_number>
  <smiles>CC1=C(CCC(O)=O)C2=CC3=[N+]4C(=CC5=C(C=C)C(C)=C6C=C7C(C=C)=C(C)C8=[N+]7[Fe@]4(N2C1=C8)N56)C(C)=C3CCC(O)=O</smiles>
  <inchi>InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+4/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;</inchi>
  <inchikey>YHLKGEDAGPGZPN-RGGAHWMASA-L</inchikey>
  <state>Solid</state>
  <cellular_locations>
    <cellular_location>Cytosol</cellular_location>
    <cellular_location>Extra-organism</cellular_location>
    <cellular_location>Membrane</cellular_location>
    <cellular_location>Periplasm</cellular_location>
  </cellular_locations>
  <predicted_properties>
    <property>
      <kind>logp</kind>
      <value>-1.01</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>logs</kind>
      <value>-5.48</value>
      <source>ALOGPS</source>
    </property>
    <property>
      <kind>solubility</kind>
      <value>2.42e-03 g/l</value>
      <source>ALOGPS</source>
    </property>
  </predicted_properties>
  <experimental_properties>
  </experimental_properties>
  <property>
    <kind>logp</kind>
    <value>2.19</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>pka_strongest_acidic</kind>
    <value>3.35</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>iupac</kind>
    <value>4,20-bis(2-carboxyethyl)-10,15-diethenyl-5,9,14,19-tetramethyl-2lambda5,22,23lambda5,25-tetraaza-1-ferraoctacyclo[11.9.1.1^{1,8}.1^{3,21}.0^{2,6}.0^{16,23}.0^{18,22}.0^{11,25}]pentacosa-2,4,6,8,10,12,14,16(23),17,19,21(24)-undecaene-2,23-bis(ylium)-1,1-diuide</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>average_mass</kind>
    <value>616.487</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>mono_mass</kind>
    <value>616.177297665</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>smiles</kind>
    <value>CC1=C(CCC(O)=O)C2=CC3=[N+]4C(=CC5=C(C=C)C(C)=C6C=C7C(C=C)=C(C)C8=[N+]7[Fe@]4(N2C1=C8)N56)C(C)=C3CCC(O)=O</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formula</kind>
    <value>C34H32FeN4O4</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchi</kind>
    <value>InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+4/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>inchikey</kind>
    <value>YHLKGEDAGPGZPN-RGGAHWMASA-L</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polar_surface_area</kind>
    <value>92.22</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>refractivity</kind>
    <value>169.77</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>polarizability</kind>
    <value>69.44</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>rotatable_bond_count</kind>
    <value>8</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>acceptor_count</kind>
    <value>4</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>donor_count</kind>
    <value>2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>physiological_charge</kind>
    <value>-2</value>
    <source>ChemAxon</source>
  </property>
  <property>
    <kind>formal_charge</kind>
    <value>0</value>
    <source>ChemAxon</source>
  </property>
  <pathways>
    <pathway>
      <name>Porphyrin and chlorophyll metabolism</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec00860</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>ABC transporters</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>ec02010</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>Metabolic pathways</name>
      <description/>
      <pathwhiz_id/>
      <kegg_map_id>eco01100</kegg_map_id>
      <subject/>
    </pathway>
    <pathway>
      <name>heme biosynthesis from uroporphyrinogen-III I</name>
      <ecocyc_pathway_id>HEME-BIOSYNTHESIS-II</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>superpathway of heme biosynthesis from uroporphyrinogen-III</name>
      <ecocyc_pathway_id>PWY0-1415</ecocyc_pathway_id>
    </pathway>
    <pathway>
      <name>heme biosynthesis from uroporphyrinogen-III II</name>
      <ecocyc_pathway_id>HEMESYN2-PWY</ecocyc_pathway_id>
    </pathway>
  </pathways>
  <spectra>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>103503</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>103504</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>540170</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>540171</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>540172</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>540173</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::CMs</type>
      <spectrum_id>792693</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135300</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135301</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135302</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135303</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135304</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135305</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135306</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135307</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135308</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135309</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135310</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135311</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135312</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135313</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135314</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135315</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135316</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135317</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135318</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::NmrOneD</type>
      <spectrum_id>135319</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1223065</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1223066</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1223067</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1338706</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1338707</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>1338708</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2302812</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2302813</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>2302814</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>3066725</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>3066726</spectrum_id>
    </spectrum>
    <spectrum>
      <type>Specdb::MsMs</type>
      <spectrum_id>3066727</spectrum_id>
    </spectrum>
  </spectra>
  <hmdb_id>HMDB03178</hmdb_id>
  <pubchem_compound_id>26945</pubchem_compound_id>
  <chemspider_id/>
  <kegg_id>C00032</kegg_id>
  <chebi_id>17627</chebi_id>
  <biocyc_id>PROTOHEME</biocyc_id>
  <het_id/>
  <wikipidia>Heme</wikipidia>
  <foodb_id/>
  <general_references>
    <reference>
      <reference_text>Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590.</reference_text>
      <pubmed_id>21097882</pubmed_id>
    </reference>
    <reference>
      <reference_text>Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114.</reference_text>
      <pubmed_id>22080510</pubmed_id>
    </reference>
    <reference>
      <reference_text>van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25.</reference_text>
      <pubmed_id>17765195</pubmed_id>
    </reference>
    <reference>
      <reference_text>Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948.</reference_text>
      <pubmed_id>18331064</pubmed_id>
    </reference>
    <reference>
      <reference_text>Ono F, Sharma BK, Smith CC, Burnett JW, Aurelian L: CD34+ cells in the peripheral blood transport herpes simplex virus DNA fragments to the skin of patients with erythema multiforme (HAEM). J Invest Dermatol. 2005 Jun;124(6):1215-24.</reference_text>
      <pubmed_id>15955097</pubmed_id>
    </reference>
    <reference>
      <reference_text>Allhorn M, Lundqvist K, Schmidtchen A, Akerstrom B: Heme-scavenging role of alpha1-microglobulin in chronic ulcers.  J Invest Dermatol. 2003 Sep;121(3):640-6.</reference_text>
      <pubmed_id>12925227</pubmed_id>
    </reference>
    <reference>
      <reference_text>Walczyk T, von Blanckenburg F: Natural iron isotope variations in human blood.  Science. 2002 Mar 15;295(5562):2065-6.</reference_text>
      <pubmed_id>11896276</pubmed_id>
    </reference>
    <reference>
      <reference_text>Kuhnel A, Gross U, Doss MO: Hereditary coproporphyria in Germany: clinical-biochemical studies in 53 patients. Clin Biochem. 2000 Aug;33(6):465-73.</reference_text>
      <pubmed_id>11074238</pubmed_id>
    </reference>
    <reference>
      <reference_text>Zhang JP, Normark S: Induction of gene expression in Escherichia coli after pilus-mediated adherence. Science. 1996 Aug 30;273(5279):1234-6.</reference_text>
      <pubmed_id>8703059</pubmed_id>
    </reference>
    <reference>
      <reference_text>Taylor TD, Litt M, Kramer P, Pandolfo M, Angelini L, Nardocci N, Davis S, Pineda M, Hattori H, Flett PJ, Cilio MR, Bertini E, Hayflick SJ: Homozygosity mapping of Hallervorden-Spatz syndrome to chromosome 20p12.3-p13. Nat Genet. 1996 Dec;14(4):479-81.</reference_text>
      <pubmed_id>8944032</pubmed_id>
    </reference>
    <reference>
      <reference_text>Park KK, Park JH, Jung YJ, Chung WY: Inhibitory effects of chlorophyllin, hemin and tetrakis(4-benzoic acid)porphyrin on oxidative DNA damage and mouse skin inflammation induced by 12-O-tetradecanoylphorbol-13-acetate as a possible anti-tumor promoting mechanism. Mutat Res. 2003 Dec 9;542(1-2):89-97.</reference_text>
      <pubmed_id>14644357</pubmed_id>
    </reference>
  </general_references>
  <synthesis_reference/>
  <msds_url/>
  <enzymes>
    <enzyme>
      <name>Ferrochelatase</name>
      <uniprot_id>P23871</uniprot_id>
      <uniprot_name>HEMH_ECOLI</uniprot_name>
      <gene_name>hemH</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P23871.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Cytochrome c biogenesis ATP-binding export protein CcmA</name>
      <uniprot_id>P33931</uniprot_id>
      <uniprot_name>CCMA_ECOLI</uniprot_name>
      <gene_name>ccmA</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P33931.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Heme exporter protein C</name>
      <uniprot_id>P0ABM1</uniprot_id>
      <uniprot_name>CCMC_ECOLI</uniprot_name>
      <gene_name>ccmC</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABM1.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Heme exporter protein B</name>
      <uniprot_id>P0ABL8</uniprot_id>
      <uniprot_name>CCMB_ECOLI</uniprot_name>
      <gene_name>ccmB</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABL8.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Heme exporter protein D</name>
      <uniprot_id>P0ABM5</uniprot_id>
      <uniprot_name>CCMD_ECOLI</uniprot_name>
      <gene_name>ccmD</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0ABM5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Protoheme IX farnesyltransferase</name>
      <uniprot_id>P0AEA5</uniprot_id>
      <uniprot_name>CYOE_ECOLI</uniprot_name>
      <gene_name>cyoE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P0AEA5.xml</protein_url>
    </enzyme>
    <enzyme>
      <name>Cytochrome c-type biogenesis protein CcmE</name>
      <uniprot_id>P69490</uniprot_id>
      <uniprot_name>CCME_ECOLI</uniprot_name>
      <gene_name>ccmE</gene_name>
      <protein_url>http://ecmdb.ca/proteins/P69490.xml</protein_url>
    </enzyme>
  </enzymes>
  <transporters>
  </transporters>
  <reactions>
    <reaction_text>Adenosine triphosphate + Water + Heme &gt; ADP + Hydrogen ion + Phosphate + Heme</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANS-RXN0-162</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Adenosine triphosphate + Water + Heme &gt; ADP + Hydrogen ion + Phosphate + Heme</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANS-RXN0-162</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Farnesyl pyrophosphate + Water + Heme &gt; Heme O + Pyrophosphate</reaction_text>
    <kegg_reaction_id>R07411</kegg_reaction_id>
    <ecocyc_id>HEMEOSYN-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Iron + Protoporphyrin IX &gt;2 Hydrogen ion + Heme</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PROTOHEMEFERROCHELAT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Protoporphyrin IX + Fe2+ &lt;&gt; Heme +2 Hydrogen ion + Fe2+</reaction_text>
    <kegg_reaction_id>R00310</kegg_reaction_id>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Heme + Water + Farnesyl pyrophosphate &lt;&gt; Heme O + Pyrophosphate</reaction_text>
    <kegg_reaction_id>R07411</kegg_reaction_id>
    <ecocyc_id>HEMEOSYN-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Heme + Hydrogen peroxide  Heme D</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN-8073</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Hydrogen ion + Heme  Protoporphyrin IX + Iron</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>RXN0-6258</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Iron + Protoporphyrin IX &gt; Heme + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>PROTOHEMEFERROCHELAT-RXN</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Heme + Adenosine triphosphate + Water &gt; Phosphate + ADP + Heme + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANS-RXN0-162</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Heme + Adenosine triphosphate + Water &gt; Phosphate + ADP + Heme + Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id>TRANS-RXN0-162</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Heme + 2 Hydrogen ion &gt; Protoporphyrin IX + Iron</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>ADP + Phosphate + 4 Hydrogen ion + Heme + Nickel(2+) + Iron chelate + Taurine + Molybdate + Magnesium + Fe3+ + Potassium + Polyamine + vitamin B12 + Sulfate + glycerol-3-phosphate + Phosphonate + D-Maltose &lt;&gt; Adenosine triphosphate +3 Hydrogen ion + Water</reaction_text>
    <kegg_reaction_id>R00086</kegg_reaction_id>
    <ecocyc_id>RXN0-1061</ecocyc_id>
    <pw_reaction_id/>
    <reaction_text>Farnesyl pyrophosphate + Water + Heme &gt; Heme O + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Protoporphyrin IX + Fe2+ &lt;&gt; Heme +2 Hydrogen ion</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
    <reaction_text>Farnesyl pyrophosphate + Water + Heme &gt; Heme O + Pyrophosphate</reaction_text>
    <kegg_reaction_id/>
    <ecocyc_id/>
    <pw_reaction_id/>
  </reactions>
  <concentrations>
  </concentrations>
</compound>
